C13H28 — CID 140612986
(4R)-2,2,4,8-tetramethylnonane (PubChem CID 140612986) has the molecular formula C13H28 and a molecular weight of 184.37 g/mol. Its IUPAC name is (4R)-2,2,4,8-tetramethylnonane.
| Compound Name | (4R)-2,2,4,8-tetramethylnonane |
|---|---|
| PubChem CID | 140612986 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | (4R)-2,2,4,8-tetramethylnonane |
| SMILES | CC(C)CCC[C@@H](C)CC(C)(C)C |
| InChI | InChI=1S/C13H28/c1-11(2)8-7-9-12(3)10-13(4,5)6/h11-12H,7-10H2,1-6H3/t12-/m1/s1 |
| InChIKey | CMTBZRAMTSWEKU-GFCCVEGCSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |