C14H30O — CID 156689448
2,2,4,9-tetramethyldecan-5-ol (PubChem CID 156689448) has the molecular formula C14H30O and a molecular weight of 214.39 g/mol. Its IUPAC name is 2,2,4,9-tetramethyldecan-5-ol.
| Compound Name | 2,2,4,9-tetramethyldecan-5-ol |
|---|---|
| PubChem CID | 156689448 |
| Molecular Formula | C14H30O |
| Molecular Weight | 214.39 g/mol |
| Exact Mass | 214.23 |
| IUPAC Name | 2,2,4,9-tetramethyldecan-5-ol |
| SMILES | CC(C)CCCC(O)C(C)CC(C)(C)C |
| InChI | InChI=1S/C14H30O/c1-11(2)8-7-9-13(15)12(3)10-14(4,5)6/h11-13,15H,7-10H2,1-6H3 |
| InChIKey | PETPVUXOMVTSKA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |