About 3-hydroxy-4,8-dimethylnonanal
3-hydroxy-4,8-dimethylnonanal (PubChem CID 87291569) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 3-hydroxy-4,8-dimethylnonanal.
Molecular Properties
| Compound Name | 3-hydroxy-4,8-dimethylnonanal |
| PubChem CID | 87291569 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 3-hydroxy-4,8-dimethylnonanal |
| SMILES | CC(C)CCCC(C)C(O)CC=O |
| InChI | InChI=1S/C11H22O2/c1-9(2)5-4-6-10(3)11(13)7-8-12/h8-11,13H,4-7H2,1-3H3 |
| InChIKey | IXEXGFLTYGOPKT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-4,8-dimethylnonanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-4,8-dimethylnonanal?
The IUPAC name of 3-hydroxy-4,8-dimethylnonanal (CID 87291569) is 3-hydroxy-4,8-dimethylnonanal.
What is the SMILES notation for 3-hydroxy-4,8-dimethylnonanal?
The canonical SMILES for 3-hydroxy-4,8-dimethylnonanal is CC(C)CCCC(C)C(O)CC=O.
What is the InChIKey of 3-hydroxy-4,8-dimethylnonanal?
The InChIKey is IXEXGFLTYGOPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-9(2)5-4-6-10(3)11(13)7-8-12/h8-11,13H,4-7H2,1-3H3.
What are the key properties of 3-hydroxy-4,8-dimethylnonanal?
3-hydroxy-4,8-dimethylnonanal has a molecular weight of 186.29 g/mol, XLogP of 2.40, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-4,8-dimethylnonanal is sourced from PubChem (CID 87291569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).