C10H20O4 — CID 139665627
(2R,3R,4R)-2,3,4-trihydroxy-8-methylnonanal (PubChem CID 139665627) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2R,3R,4R)-2,3,4-trihydroxy-8-methylnonanal.
| Compound Name | (2R,3R,4R)-2,3,4-trihydroxy-8-methylnonanal |
|---|---|
| PubChem CID | 139665627 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (2R,3R,4R)-2,3,4-trihydroxy-8-methylnonanal |
| SMILES | CC(C)CCC[C@@H](O)[C@@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C10H20O4/c1-7(2)4-3-5-8(12)10(14)9(13)6-11/h6-10,12-14H,3-5H2,1-2H3/t8-,9+,10-/m1/s1 |
| InChIKey | YCLVGQZYCCOHNT-KXUCPTDWSA-N |
| XLogP | 0.09 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|