C20H40O2 — CID 91588930
2-hydroxy-3,7,11,15-tetramethylhexadecanal (PubChem CID 91588930) has the molecular formula C20H40O2 and a molecular weight of 312.54 g/mol. Its IUPAC name is 2-hydroxy-3,7,11,15-tetramethylhexadecanal.
| Compound Name | 2-hydroxy-3,7,11,15-tetramethylhexadecanal |
|---|---|
| PubChem CID | 91588930 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | 2-hydroxy-3,7,11,15-tetramethylhexadecanal |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)C(O)C=O |
| InChI | InChI=1S/C20H40O2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)20(22)15-21/h15-20,22H,6-14H2,1-5H3 |
| InChIKey | UKGFZLIWHAFELS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|