C6H12O2 — CID 89028923
(2R,3R)-2-hydroxy-3-methylpentanal (PubChem CID 89028923) has the molecular formula C6H12O2 and a molecular weight of 116.16 g/mol. Its IUPAC name is (2R,3R)-2-hydroxy-3-methylpentanal.
| Compound Name | (2R,3R)-2-hydroxy-3-methylpentanal |
|---|---|
| PubChem CID | 89028923 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | (2R,3R)-2-hydroxy-3-methylpentanal |
| SMILES | CC[C@@H](C)[C@@H](O)C=O |
| InChI | InChI=1S/C6H12O2/c1-3-5(2)6(8)4-7/h4-6,8H,3H2,1-2H3/t5-,6+/m1/s1 |
| InChIKey | IBQPEMCNMXJFSB-RITPCOANSA-N |
| XLogP | 0.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|