About 2-hydroxybutanal;silane;hydrate
2-hydroxybutanal;silane;hydrate (PubChem CID 174946258) has the molecular formula C4H14O3Si
and a molecular weight of 138.24 g/mol. Its IUPAC name is 2-hydroxybutanal;silane;hydrate.
Molecular Properties
| Compound Name | 2-hydroxybutanal;silane;hydrate |
| PubChem CID | 174946258 |
| Molecular Formula | C4H14O3Si |
| Molecular Weight | 138.24 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 2-hydroxybutanal;silane;hydrate |
| SMILES | CCC(O)C=O.O.[SiH4] |
| InChI | InChI=1S/C4H8O2.H2O.H4Si/c1-2-4(6)3-5;;/h3-4,6H,2H2,1H3;1H2;1H4 |
| InChIKey | FWMOQZNBHWIKFF-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.24 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybutanal;silane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybutanal;silane;hydrate?
The IUPAC name of 2-hydroxybutanal;silane;hydrate (CID 174946258) is 2-hydroxybutanal;silane;hydrate.
What is the SMILES notation for 2-hydroxybutanal;silane;hydrate?
The canonical SMILES for 2-hydroxybutanal;silane;hydrate is CCC(O)C=O.O.[SiH4].
What is the InChIKey of 2-hydroxybutanal;silane;hydrate?
The InChIKey is FWMOQZNBHWIKFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.H2O.H4Si/c1-2-4(6)3-5;;/h3-4,6H,2H2,1H3;1H2;1H4.
What are the key properties of 2-hydroxybutanal;silane;hydrate?
2-hydroxybutanal;silane;hydrate has a molecular weight of 138.24 g/mol, XLogP of -2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutanal;silane;hydrate is sourced from PubChem (CID 174946258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).