About 2-hydroxybutanethial
2-hydroxybutanethial (PubChem CID 14141721) has the molecular formula C4H8OS
and a molecular weight of 104.17 g/mol. Its IUPAC name is 2-hydroxybutanethial.
Molecular Properties
| Compound Name | 2-hydroxybutanethial |
| PubChem CID | 14141721 |
| Molecular Formula | C4H8OS |
| Molecular Weight | 104.17 g/mol |
| Exact Mass | 104.03 |
| IUPAC Name | 2-hydroxybutanethial |
| SMILES | CCC(O)C=S |
| InChI | InChI=1S/C4H8OS/c1-2-4(5)3-6/h3-5H,2H2,1H3 |
| InChIKey | UWWMKGDMTSCMJT-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybutanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybutanethial?
The IUPAC name of 2-hydroxybutanethial (CID 14141721) is 2-hydroxybutanethial.
What is the SMILES notation for 2-hydroxybutanethial?
The canonical SMILES for 2-hydroxybutanethial is CCC(O)C=S.
What is the InChIKey of 2-hydroxybutanethial?
The InChIKey is UWWMKGDMTSCMJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8OS/c1-2-4(5)3-6/h3-5H,2H2,1H3.
What are the key properties of 2-hydroxybutanethial?
2-hydroxybutanethial has a molecular weight of 104.17 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutanethial is sourced from PubChem (CID 14141721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).