About 2-hydroxypentanethial
2-hydroxypentanethial (PubChem CID 54438498) has the molecular formula C5H10OS
and a molecular weight of 118.20 g/mol. Its IUPAC name is 2-hydroxypentanethial.
Molecular Properties
| Compound Name | 2-hydroxypentanethial |
| PubChem CID | 54438498 |
| Molecular Formula | C5H10OS |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | 2-hydroxypentanethial |
| SMILES | CCCC(O)C=S |
| InChI | InChI=1S/C5H10OS/c1-2-3-5(6)4-7/h4-6H,2-3H2,1H3 |
| InChIKey | PGZFDKBEXIUMDK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypentanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypentanethial?
The IUPAC name of 2-hydroxypentanethial (CID 54438498) is 2-hydroxypentanethial.
What is the SMILES notation for 2-hydroxypentanethial?
The canonical SMILES for 2-hydroxypentanethial is CCCC(O)C=S.
What is the InChIKey of 2-hydroxypentanethial?
The InChIKey is PGZFDKBEXIUMDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10OS/c1-2-3-5(6)4-7/h4-6H,2-3H2,1H3.
What are the key properties of 2-hydroxypentanethial?
2-hydroxypentanethial has a molecular weight of 118.20 g/mol, XLogP of 1.15, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypentanethial is sourced from PubChem (CID 54438498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).