C8H14O2 — CID 140987996
octa-1,3-diene-3,5-diol (PubChem CID 140987996) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is octa-1,3-diene-3,5-diol.
| Compound Name | octa-1,3-diene-3,5-diol |
|---|---|
| PubChem CID | 140987996 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | octa-1,3-diene-3,5-diol |
| SMILES | C=CC(O)=CC(O)CCC |
| InChI | InChI=1S/C8H14O2/c1-3-5-8(10)6-7(9)4-2/h4,6,8-10H,2-3,5H2,1H3 |
| InChIKey | IFENOLNHOFMBPR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|