C14H24O2 — CID 170250028
(4S,5Z,7E,9E,11R)-tetradeca-5,7,9-triene-4,11-diol (PubChem CID 170250028) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (4S,5Z,7E,9E,11R)-tetradeca-5,7,9-triene-4,11-diol.
| Compound Name | (4S,5Z,7E,9E,11R)-tetradeca-5,7,9-triene-4,11-diol |
|---|---|
| PubChem CID | 170250028 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (4S,5Z,7E,9E,11R)-tetradeca-5,7,9-triene-4,11-diol |
| SMILES | CCC[C@H](O)/C=C\C=C\C=C\[C@H](O)CCC |
| InChI | InChI=1S/C14H24O2/c1-3-9-13(15)11-7-5-6-8-12-14(16)10-4-2/h5-8,11-16H,3-4,9-10H2,1-2H3/b6-5+,11-7-,12-8+/t13-,14+/m0/s1 |
| InChIKey | BAHVROGAKDQCPD-KESMCHGZSA-N |
| XLogP | 2.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|