C21H37NO2 — CID 175900559
1-(dipropylamino)pentadeca-4,6,8,12-tetraene-3,10-diol (PubChem CID 175900559) has the molecular formula C21H37NO2 and a molecular weight of 335.53 g/mol. Its IUPAC name is 1-(dipropylamino)pentadeca-4,6,8,12-tetraene-3,10-diol.
| Compound Name | 1-(dipropylamino)pentadeca-4,6,8,12-tetraene-3,10-diol |
|---|---|
| PubChem CID | 175900559 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | 1-(dipropylamino)pentadeca-4,6,8,12-tetraene-3,10-diol |
| SMILES | CCC=CCC(O)C=CC=CC=CC(O)CCN(CCC)CCC |
| InChI | InChI=1S/C21H37NO2/c1-4-7-10-13-20(23)14-11-8-9-12-15-21(24)16-19-22(17-5-2)18-6-3/h7-12,14-15,20-21,23-24H,4-6,13,16-19H2,1-3H3 |
| InChIKey | VRZUVZKAYUZTFQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|