C23H34O4 — CID 155000456
methyl (4Z,9E,11E,13Z,15E,19Z)-8,17-dihydroxydocosa-4,9,11,13,15,19-hexaenoate (PubChem CID 155000456) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is methyl (4Z,9E,11E,13Z,15E,19Z)-8,17-dihydroxydocosa-4,9,11,13,15,19-hexaenoate.
| Compound Name | methyl (4Z,9E,11E,13Z,15E,19Z)-8,17-dihydroxydocosa-4,9,11,13,15,19-hexaenoate |
|---|---|
| PubChem CID | 155000456 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | methyl (4Z,9E,11E,13Z,15E,19Z)-8,17-dihydroxydocosa-4,9,11,13,15,19-hexaenoate |
| SMILES | CC/C=C\CC(O)/C=C/C=C\C=C\C=C\C(O)CC/C=C\CCC(=O)OC |
| InChI | InChI=1S/C23H34O4/c1-3-4-11-16-21(24)17-12-7-5-6-8-13-18-22(25)19-14-9-10-15-20-23(26)27-2/h4-13,17-18,21-22,24-25H,3,14-16,19-20H2,1-2H3/b7-5-,8-6+,10-9-,11-4-,17-12+,18-13+ |
| InChIKey | IBKPGNRBYSEPJG-KHCBMHAJSA-N |
| XLogP | 4.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|