C19H32O3 — CID 10448018
methyl (9Z,11E,15Z)-13-hydroxyoctadeca-9,11,15-trienoate (PubChem CID 10448018) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is methyl (9Z,11E,15Z)-13-hydroxyoctadeca-9,11,15-trienoate.
| Compound Name | methyl (9Z,11E,15Z)-13-hydroxyoctadeca-9,11,15-trienoate |
|---|---|
| PubChem CID | 10448018 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | methyl (9Z,11E,15Z)-13-hydroxyoctadeca-9,11,15-trienoate |
| SMILES | CC/C=C\CC(O)/C=C/C=C\CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H32O3/c1-3-4-12-15-18(20)16-13-10-8-6-5-7-9-11-14-17-19(21)22-2/h4,8,10,12-13,16,18,20H,3,5-7,9,11,14-15,17H2,1-2H3/b10-8-,12-4-,16-13+ |
| InChIKey | JMEPYUAUPCWTSQ-CTIIKXKSSA-N |
| XLogP | 4.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|