C23H38O6 — CID 157005144
[(2R)-3-acetyloxy-2-hydroxypropyl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate (PubChem CID 157005144) has the molecular formula C23H38O6 and a molecular weight of 410.55 g/mol. Its IUPAC name is [(2R)-3-acetyloxy-2-hydroxypropyl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate.
| Compound Name | [(2R)-3-acetyloxy-2-hydroxypropyl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate |
|---|---|
| PubChem CID | 157005144 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | [(2R)-3-acetyloxy-2-hydroxypropyl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate |
| SMILES | CC/C=C/CC(O)/C=C/C=C/CCCCCCCC(=O)OC[C@H](O)COC(C)=O |
| InChI | InChI=1S/C23H38O6/c1-3-4-12-15-21(25)16-13-10-8-6-5-7-9-11-14-17-23(27)29-19-22(26)18-28-20(2)24/h4,8,10,12-13,16,21-22,25-26H,3,5-7,9,11,14-15,17-19H2,1-2H3/b10-8+,12-4+,16-13+/t21?,22-/m1/s1 |
| InChIKey | WHGJCCSMTQDOCV-UYMCUMKHSA-N |
| XLogP | 4.01 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|