C27H40O6 — CID 157005125
[(2S)-3-acetyloxy-2-hydroxypropyl] (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoate (PubChem CID 157005125) has the molecular formula C27H40O6 and a molecular weight of 460.61 g/mol. Its IUPAC name is [(2S)-3-acetyloxy-2-hydroxypropyl] (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoate.
| Compound Name | [(2S)-3-acetyloxy-2-hydroxypropyl] (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoate |
|---|---|
| PubChem CID | 157005125 |
| Molecular Formula | C27H40O6 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | [(2S)-3-acetyloxy-2-hydroxypropyl] (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\CC(O)/C=C/C=C\C/C=C\C/C=C\CCC(=O)OC[C@@H](O)COC(C)=O |
| InChI | InChI=1S/C27H40O6/c1-3-4-5-6-13-16-19-25(29)20-17-14-11-9-7-8-10-12-15-18-21-27(31)33-23-26(30)22-32-24(2)28/h4-5,7-8,11-17,20,25-26,29-30H,3,6,9-10,18-19,21-23H2,1-2H3/b5-4-,8-7-,14-11-,15-12-,16-13-,20-17+/t25?,26-/m0/s1 |
| InChIKey | XQPDOOPASJDOHU-VSCDHRDYSA-N |
| XLogP | 4.90 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|