C21H34O4 — CID 162894313
methyl 13-acetyloxyoctadeca-9,11,15-trienoate (PubChem CID 162894313) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is methyl 13-acetyloxyoctadeca-9,11,15-trienoate.
| Compound Name | methyl 13-acetyloxyoctadeca-9,11,15-trienoate |
|---|---|
| PubChem CID | 162894313 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | methyl 13-acetyloxyoctadeca-9,11,15-trienoate |
| SMILES | CCC=CCC(C=CC=CCCCCCCCC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C21H34O4/c1-4-5-13-16-20(25-19(2)22)17-14-11-9-7-6-8-10-12-15-18-21(23)24-3/h5,9,11,13-14,17,20H,4,6-8,10,12,15-16,18H2,1-3H3 |
| InChIKey | XXQCJTKSMNNZSF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|