C23H35NO3 — CID 126755917
methyl (4Z,7S,8E,10E,12Z)-7-hydroxy-13-[methyl-[(2Z,5Z)-octa-2,5-dienyl]amino]trideca-4,8,10,12-tetraenoate (PubChem CID 126755917) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is methyl (4Z,7S,8E,10E,12Z)-7-hydroxy-13-[methyl-[(2Z,5Z)-octa-2,5-dienyl]amino]trideca-4,8,10,12-tetraenoate.
| Compound Name | methyl (4Z,7S,8E,10E,12Z)-7-hydroxy-13-[methyl-[(2Z,5Z)-octa-2,5-dienyl]amino]trideca-4,8,10,12-tetraenoate |
|---|---|
| PubChem CID | 126755917 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | methyl (4Z,7S,8E,10E,12Z)-7-hydroxy-13-[methyl-[(2Z,5Z)-octa-2,5-dienyl]amino]trideca-4,8,10,12-tetraenoate |
| SMILES | CC/C=C\C/C=C\CN(C)/C=C\C=C\C=C\[C@@H](O)C/C=C\CCC(=O)OC |
| InChI | InChI=1S/C23H35NO3/c1-4-5-6-7-9-15-20-24(2)21-16-10-8-12-17-22(25)18-13-11-14-19-23(26)27-3/h5-6,8-13,15-17,21-22,25H,4,7,14,18-20H2,1-3H3/b6-5-,10-8+,13-11-,15-9-,17-12+,21-16-/t22-/m1/s1 |
| InChIKey | LAPNDZNOCRGYSL-GVCSXRLFSA-N |
| XLogP | 4.72 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|