C25H34O5 — CID 166964069
methyl 3-[4-[(3S,4E,6Z,8E,10S,12Z)-3,10-dihydroxypentadeca-4,6,8,12-tetraenoxy]phenyl]propanoate (PubChem CID 166964069) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is methyl 3-[4-[(3S,4E,6Z,8E,10S,12Z)-3,10-dihydroxypentadeca-4,6,8,12-tetraenoxy]phenyl]propanoate.
| Compound Name | methyl 3-[4-[(3S,4E,6Z,8E,10S,12Z)-3,10-dihydroxypentadeca-4,6,8,12-tetraenoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 166964069 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | methyl 3-[4-[(3S,4E,6Z,8E,10S,12Z)-3,10-dihydroxypentadeca-4,6,8,12-tetraenoxy]phenyl]propanoate |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\C=C\[C@@H](O)CCOc1ccc(CCC(=O)OC)cc1 |
| InChI | InChI=1S/C25H34O5/c1-3-4-7-10-22(26)11-8-5-6-9-12-23(27)19-20-30-24-16-13-21(14-17-24)15-18-25(28)29-2/h4-9,11-14,16-17,22-23,26-27H,3,10,15,18-20H2,1-2H3/b6-5-,7-4-,11-8+,12-9+/t22-,23+/m0/s1 |
| InChIKey | XSOHYVFDUFKUJU-CMPDNCRRSA-N |
| XLogP | 4.31 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|