C22H36O4 — CID 135226178
(10S,11E,13Z,15E,17S,19Z)-10,17-dihydroxydocosa-11,13,15,19-tetraenoic acid (PubChem CID 135226178) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is (10S,11E,13Z,15E,17S,19Z)-10,17-dihydroxydocosa-11,13,15,19-tetraenoic acid.
| Compound Name | (10S,11E,13Z,15E,17S,19Z)-10,17-dihydroxydocosa-11,13,15,19-tetraenoic acid |
|---|---|
| PubChem CID | 135226178 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (10S,11E,13Z,15E,17S,19Z)-10,17-dihydroxydocosa-11,13,15,19-tetraenoic acid |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\C=C\[C@@H](O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H36O4/c1-2-3-10-15-20(23)17-12-8-9-13-18-21(24)16-11-6-4-5-7-14-19-22(25)26/h3,8-10,12-13,17-18,20-21,23-24H,2,4-7,11,14-16,19H2,1H3,(H,25,26)/b9-8-,10-3-,17-12+,18-13+/t20-,21-/m0/s1 |
| InChIKey | QDNDAYLDIZBETM-JIZXNDQTSA-N |
| XLogP | 4.94 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|