C23H36O5 — CID 89319513
(8E,10Z,12Z,14E,16R,19Z)-7,16,17-trihydroxy-16-methyldocosa-8,10,12,14,19-pentaenoic acid (PubChem CID 89319513) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is (8E,10Z,12Z,14E,16R,19Z)-7,16,17-trihydroxy-16-methyldocosa-8,10,12,14,19-pentaenoic acid.
| Compound Name | (8E,10Z,12Z,14E,16R,19Z)-7,16,17-trihydroxy-16-methyldocosa-8,10,12,14,19-pentaenoic acid |
|---|---|
| PubChem CID | 89319513 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | (8E,10Z,12Z,14E,16R,19Z)-7,16,17-trihydroxy-16-methyldocosa-8,10,12,14,19-pentaenoic acid |
| SMILES | CC/C=C\CC(O)[C@](C)(O)/C=C/C=C\C=C/C=C/C(O)CCCCCC(=O)O |
| InChI | InChI=1S/C23H36O5/c1-3-4-10-17-21(25)23(2,28)19-14-8-6-5-7-11-15-20(24)16-12-9-13-18-22(26)27/h4-8,10-11,14-15,19-21,24-25,28H,3,9,12-13,16-18H2,1-2H3,(H,26,27)/b7-5-,8-6-,10-4-,15-11+,19-14+/t20?,21?,23-/m1/s1 |
| InChIKey | ZGZKAKXWYOAALG-HNEGSESKSA-N |
| XLogP | 4.08 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|