7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid

C22H34O5 — CID 162821627

IUPAC7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid
SMILESCCC(O)C=CC=CC=CC(O)CC=CC=CC(O)CCCCCC(=O)O
InChIInChI=1S/C22H34O5/c1-2-19(23)13-7-3-4-8-14-20(24)15-9-5-10-16-21(25)17-11-6-12-18-22(26)27/h3-5,7-10,13-14,16,19-21,23-25H,2,6,11-12,15,17-18H2,1H3,(H,26,27)
InChIKeyGGPSRSCVYRYOSY-UHFFFAOYSA-N
MW378.51 g/mol
LogP3.69
Rot. Bonds15

About 7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid

7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid (PubChem CID 162821627) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is 7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid.

Molecular Properties

Compound Name7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid
PubChem CID162821627
Molecular FormulaC22H34O5
Molecular Weight378.51 g/mol
Exact Mass378.24
IUPAC Name7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid
SMILESCCC(O)C=CC=CC=CC(O)CC=CC=CC(O)CCCCCC(=O)O
InChIInChI=1S/C22H34O5/c1-2-19(23)13-7-3-4-8-14-20(24)15-9-5-10-16-21(25)17-11-6-12-18-22(26)27/h3-5,7-10,13-14,16,19-21,23-25H,2,6,11-12,15,17-18H2,1H3,(H,26,27)
InChIKeyGGPSRSCVYRYOSY-UHFFFAOYSA-N
XLogP3.69
TPSA97.99 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds15
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500378.51
LogP ≤ 53.69
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid?
The IUPAC name of 7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid (CID 162821627) is 7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid.
What is the SMILES notation for 7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid?
The canonical SMILES for 7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid is CCC(O)C=CC=CC=CC(O)CC=CC=CC(O)CCCCCC(=O)O.
What is the InChIKey of 7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid?
The InChIKey is GGPSRSCVYRYOSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34O5/c1-2-19(23)13-7-3-4-8-14-20(24)15-9-5-10-16-21(25)17-11-6-12-18-22(26)27/h3-5,7-10,13-14,16,19-21,23-25H,2,6,11-12,15,17-18H2,1H3,(H,26,27).
What are the key properties of 7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid?
7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid has a molecular weight of 378.51 g/mol, XLogP of 3.69, 15 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid is sourced from PubChem (CID 162821627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).