C22H34O5 — CID 162821627
7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid (PubChem CID 162821627) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is 7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid.
| Compound Name | 7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid |
|---|---|
| PubChem CID | 162821627 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid |
| SMILES | CCC(O)C=CC=CC=CC(O)CC=CC=CC(O)CCCCCC(=O)O |
| InChI | InChI=1S/C22H34O5/c1-2-19(23)13-7-3-4-8-14-20(24)15-9-5-10-16-21(25)17-11-6-12-18-22(26)27/h3-5,7-10,13-14,16,19-21,23-25H,2,6,11-12,15,17-18H2,1H3,(H,26,27) |
| InChIKey | GGPSRSCVYRYOSY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|