C20H29NaO5 — CID 171042279
sodium (5S,6E,8E,10E,12R,14E,16E,18R)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoate (PubChem CID 171042279) has the molecular formula C20H29NaO5 and a molecular weight of 372.44 g/mol. Its IUPAC name is sodium (5S,6E,8E,10E,12R,14E,16E,18R)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoate.
| Compound Name | sodium (5S,6E,8E,10E,12R,14E,16E,18R)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoate |
|---|---|
| PubChem CID | 171042279 |
| Molecular Formula | C20H29NaO5 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | sodium (5S,6E,8E,10E,12R,14E,16E,18R)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoate |
| SMILES | CC[C@@H](O)/C=C/C=C/C[C@@H](O)/C=C/C=C/C=C/[C@@H](O)CCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H30O5.Na/c1-2-17(21)11-8-5-9-14-18(22)12-6-3-4-7-13-19(23)15-10-16-20(24)25;/h3-9,11-13,17-19,21-23H,2,10,14-16H2,1H3,(H,24,25);/q;+1/p-1/b4-3+,9-5+,11-8+,12-6+,13-7+;/t17-,18+,19-;/m1./s1 |
| InChIKey | WUXDCPCRUFHVSO-XHPYLENKSA-M |
| XLogP | -1.43 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|