C19H29O3- — CID 161329194
(7Z,9Z,12Z,14E)-6-hydroxy-16-methyloctadeca-7,9,12,14-tetraenoate (PubChem CID 161329194) has the molecular formula C19H29O3- and a molecular weight of 305.44 g/mol. Its IUPAC name is (7Z,9Z,12Z,14E)-6-hydroxy-16-methyloctadeca-7,9,12,14-tetraenoate.
| Compound Name | (7Z,9Z,12Z,14E)-6-hydroxy-16-methyloctadeca-7,9,12,14-tetraenoate |
|---|---|
| PubChem CID | 161329194 |
| Molecular Formula | C19H29O3- |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (7Z,9Z,12Z,14E)-6-hydroxy-16-methyloctadeca-7,9,12,14-tetraenoate |
| SMILES | CCC(C)/C=C/C=C\C/C=C\C=C/C(O)CCCCC(=O)[O-] |
| InChI | InChI=1S/C19H30O3/c1-3-17(2)13-9-7-5-4-6-8-10-14-18(20)15-11-12-16-19(21)22/h5-10,13-14,17-18,20H,3-4,11-12,15-16H2,1-2H3,(H,21,22)/p-1/b7-5-,8-6-,13-9+,14-10- |
| InChIKey | VLENJTDGVNZLEP-ZMRLPVCMSA-M |
| XLogP | 3.32 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|