C23H36O5 — CID 53308912
propan-2-yl (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoate (PubChem CID 53308912) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is propan-2-yl (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoate.
| Compound Name | propan-2-yl (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoate |
|---|---|
| PubChem CID | 53308912 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | propan-2-yl (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoate |
| SMILES | CC[C@@H](O)/C=C/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)OC(C)C |
| InChI | InChI=1S/C23H36O5/c1-4-20(24)13-10-7-11-16-21(25)14-8-5-6-9-15-22(26)17-12-18-23(27)28-19(2)3/h5-11,13-15,19-22,24-26H,4,12,16-18H2,1-3H3/b6-5+,11-7-,13-10+,14-8+,15-9-/t20-,21+,22-/m1/s1 |
| InChIKey | IGFILECFRVKKKY-UPADLKRESA-N |
| XLogP | 3.77 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|