C17H30O3 — CID 23249480
[(3R,5E,7Z,9R)-9-hydroxy-2-methyltetradeca-5,7-dien-3-yl] acetate (PubChem CID 23249480) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is [(3R,5E,7Z,9R)-9-hydroxy-2-methyltetradeca-5,7-dien-3-yl] acetate.
| Compound Name | [(3R,5E,7Z,9R)-9-hydroxy-2-methyltetradeca-5,7-dien-3-yl] acetate |
|---|---|
| PubChem CID | 23249480 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | [(3R,5E,7Z,9R)-9-hydroxy-2-methyltetradeca-5,7-dien-3-yl] acetate |
| SMILES | CCCCC[C@@H](O)/C=C\C=C\C[C@@H](OC(C)=O)C(C)C |
| InChI | InChI=1S/C17H30O3/c1-5-6-8-11-16(19)12-9-7-10-13-17(14(2)3)20-15(4)18/h7,9-10,12,14,16-17,19H,5-6,8,11,13H2,1-4H3/b10-7+,12-9-/t16-,17-/m1/s1 |
| InChIKey | RVEVFRGVTMKYSR-DAOVMUMSSA-N |
| XLogP | 4.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|