C25H40O7 — CID 157005107
[(2S)-2-acetyloxy-3-hydroxypropyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate (PubChem CID 157005107) has the molecular formula C25H40O7 and a molecular weight of 452.59 g/mol. Its IUPAC name is [(2S)-2-acetyloxy-3-hydroxypropyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate.
| Compound Name | [(2S)-2-acetyloxy-3-hydroxypropyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 157005107 |
| Molecular Formula | C25H40O7 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | [(2S)-2-acetyloxy-3-hydroxypropyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
| SMILES | CCCCC[C@H](O)/C=C/C=C\C/C=C\C=C\[C@H](O)CCCC(=O)OC[C@H](CO)OC(C)=O |
| InChI | InChI=1S/C25H40O7/c1-3-4-10-14-22(28)15-11-8-6-5-7-9-12-16-23(29)17-13-18-25(30)31-20-24(19-26)32-21(2)27/h6-9,11-12,15-16,22-24,26,28-29H,3-5,10,13-14,17-20H2,1-2H3/b8-6-,9-7-,15-11+,16-12+/t22-,23-,24-/m0/s1 |
| InChIKey | ZLROPUHMZPJGGI-FGWOOYDVSA-N |
| XLogP | 3.54 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|