C29H50O6 — CID 157005346
[(2S)-1-hydroxy-3-octanoyloxypropan-2-yl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate (PubChem CID 157005346) has the molecular formula C29H50O6 and a molecular weight of 494.71 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-octanoyloxypropan-2-yl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate.
| Compound Name | [(2S)-1-hydroxy-3-octanoyloxypropan-2-yl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate |
|---|---|
| PubChem CID | 157005346 |
| Molecular Formula | C29H50O6 |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | [(2S)-1-hydroxy-3-octanoyloxypropan-2-yl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate |
| SMILES | CC/C=C/C/C=C/C=C/C(O)CCCCCCCC(=O)O[C@@H](CO)COC(=O)CCCCCCC |
| InChI | InChI=1S/C29H50O6/c1-3-5-7-9-10-13-16-20-26(31)21-17-14-11-15-19-23-29(33)35-27(24-30)25-34-28(32)22-18-12-8-6-4-2/h5,7,10,13,16,20,26-27,30-31H,3-4,6,8-9,11-12,14-15,17-19,21-25H2,1-2H3/b7-5+,13-10+,20-16+/t26?,27-/m0/s1 |
| InChIKey | GNRVTJJMBKRNHS-QNALYWLHSA-N |
| XLogP | 6.35 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|