C33H56O7 — CID 157002657
[(2S)-2-decanoyloxy-3-hydroxypropyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate (PubChem CID 157002657) has the molecular formula C33H56O7 and a molecular weight of 564.80 g/mol. Its IUPAC name is [(2S)-2-decanoyloxy-3-hydroxypropyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate.
| Compound Name | [(2S)-2-decanoyloxy-3-hydroxypropyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 157002657 |
| Molecular Formula | C33H56O7 |
| Molecular Weight | 564.80 g/mol |
| Exact Mass | 564.40 |
| IUPAC Name | [(2S)-2-decanoyloxy-3-hydroxypropyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
| SMILES | CCCCCCCCCC(=O)O[C@@H](CO)COC(=O)CCC[C@@H](O)/C=C/C=C\C/C=C\C=C\[C@@H](O)CCCCC |
| InChI | InChI=1S/C33H56O7/c1-3-5-7-8-10-15-19-25-33(38)40-31(27-34)28-39-32(37)26-20-24-30(36)23-18-14-12-9-11-13-17-22-29(35)21-16-6-4-2/h11-14,17-18,22-23,29-31,34-36H,3-10,15-16,19-21,24-28H2,1-2H3/b13-11-,14-12-,22-17+,23-18+/t29-,30-,31-/m0/s1 |
| InChIKey | OEJZRSOZRQZZJL-PMQCYETJSA-N |
| XLogP | 6.66 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.80 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|