C36H62O7 — CID 157006769
[(2S)-3-hydroxy-2-(11-methyldodecanoyloxy)propyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate (PubChem CID 157006769) has the molecular formula C36H62O7 and a molecular weight of 606.89 g/mol. Its IUPAC name is [(2S)-3-hydroxy-2-(11-methyldodecanoyloxy)propyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate.
| Compound Name | [(2S)-3-hydroxy-2-(11-methyldodecanoyloxy)propyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 157006769 |
| Molecular Formula | C36H62O7 |
| Molecular Weight | 606.89 g/mol |
| Exact Mass | 606.45 |
| IUPAC Name | [(2S)-3-hydroxy-2-(11-methyldodecanoyloxy)propyl] (5R,6E,8Z,11Z,13E,15S)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
| SMILES | CCCCC[C@H](O)/C=C/C=C\C/C=C\C=C\[C@H](O)CCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCCC(C)C |
| InChI | InChI=1S/C36H62O7/c1-4-5-16-23-32(38)24-18-13-9-7-10-14-19-25-33(39)26-21-28-35(40)42-30-34(29-37)43-36(41)27-20-15-11-6-8-12-17-22-31(2)3/h9-10,13-14,18-19,24-25,31-34,37-39H,4-8,11-12,15-17,20-23,26-30H2,1-3H3/b13-9-,14-10-,24-18+,25-19+/t32-,33-,34-/m0/s1 |
| InChIKey | CITKGGKXUPHYSW-PBCMLPANSA-N |
| XLogP | 7.69 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.89 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|