C36H60O6 — CID 157006756
[(2S)-1-hydroxy-3-(11-methyldodecanoyloxy)propan-2-yl] (6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoate (PubChem CID 157006756) has the molecular formula C36H60O6 and a molecular weight of 588.87 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-(11-methyldodecanoyloxy)propan-2-yl] (6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoate.
| Compound Name | [(2S)-1-hydroxy-3-(11-methyldodecanoyloxy)propan-2-yl] (6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 157006756 |
| Molecular Formula | C36H60O6 |
| Molecular Weight | 588.87 g/mol |
| Exact Mass | 588.44 |
| IUPAC Name | [(2S)-1-hydroxy-3-(11-methyldodecanoyloxy)propan-2-yl] (6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C=C\C(O)CCCC(=O)O[C@@H](CO)COC(=O)CCCCCCCCCC(C)C |
| InChI | InChI=1S/C36H60O6/c1-4-5-6-7-8-9-10-11-12-13-16-19-22-26-33(38)27-24-29-36(40)42-34(30-37)31-41-35(39)28-23-20-17-14-15-18-21-25-32(2)3/h5-6,8-9,11-12,16,19,22,26,32-34,37-38H,4,7,10,13-15,17-18,20-21,23-25,27-31H2,1-3H3/b6-5-,9-8-,12-11-,19-16-,26-22+/t33?,34-/m0/s1 |
| InChIKey | FZGJJAGVQDHBLT-JZBZQZENSA-N |
| XLogP | 8.49 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.87 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|