C33H58O6 — CID 157006593
[(2S)-3-hydroxy-2-(10-methylundecanoyloxy)propyl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate (PubChem CID 157006593) has the molecular formula C33H58O6 and a molecular weight of 550.82 g/mol. Its IUPAC name is [(2S)-3-hydroxy-2-(10-methylundecanoyloxy)propyl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate.
| Compound Name | [(2S)-3-hydroxy-2-(10-methylundecanoyloxy)propyl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate |
|---|---|
| PubChem CID | 157006593 |
| Molecular Formula | C33H58O6 |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.42 |
| IUPAC Name | [(2S)-3-hydroxy-2-(10-methylundecanoyloxy)propyl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate |
| SMILES | CC/C=C/C/C=C/C=C/C(O)CCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCC(C)C |
| InChI | InChI=1S/C33H58O6/c1-4-5-6-7-8-13-18-23-30(35)24-19-14-11-16-20-25-32(36)38-28-31(27-34)39-33(37)26-21-15-10-9-12-17-22-29(2)3/h5-6,8,13,18,23,29-31,34-35H,4,7,9-12,14-17,19-22,24-28H2,1-3H3/b6-5+,13-8+,23-18+/t30?,31-/m0/s1 |
| InChIKey | DELWPZFCMWVFHV-MSUVCSCNSA-N |
| XLogP | 7.77 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|