C31H50O6 — CID 157005302
[(2S)-1-hydroxy-3-octanoyloxypropan-2-yl] (6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoate (PubChem CID 157005302) has the molecular formula C31H50O6 and a molecular weight of 518.74 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-octanoyloxypropan-2-yl] (6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoate.
| Compound Name | [(2S)-1-hydroxy-3-octanoyloxypropan-2-yl] (6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 157005302 |
| Molecular Formula | C31H50O6 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | [(2S)-1-hydroxy-3-octanoyloxypropan-2-yl] (6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C=C\C(O)CCCC(=O)O[C@@H](CO)COC(=O)CCCCCCC |
| InChI | InChI=1S/C31H50O6/c1-3-5-7-9-10-11-12-13-14-15-16-18-19-22-28(33)23-21-25-31(35)37-29(26-32)27-36-30(34)24-20-17-8-6-4-2/h5,7,10-11,13-14,16,18-19,22,28-29,32-33H,3-4,6,8-9,12,15,17,20-21,23-27H2,1-2H3/b7-5-,11-10-,14-13-,18-16-,22-19+/t28?,29-/m0/s1 |
| InChIKey | UXTOMVAVSUWAAU-GYXKVCTLSA-N |
| XLogP | 6.69 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|