C23H36O5 — CID 156963902
1,3-dihydroxypropan-2-yl (5Z,8Z,11Z,14Z,16E,18R)-18-hydroxyicosa-5,8,11,14,16-pentaenoate (PubChem CID 156963902) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl (5Z,8Z,11Z,14Z,16E,18R)-18-hydroxyicosa-5,8,11,14,16-pentaenoate.
| Compound Name | 1,3-dihydroxypropan-2-yl (5Z,8Z,11Z,14Z,16E,18R)-18-hydroxyicosa-5,8,11,14,16-pentaenoate |
|---|---|
| PubChem CID | 156963902 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl (5Z,8Z,11Z,14Z,16E,18R)-18-hydroxyicosa-5,8,11,14,16-pentaenoate |
| SMILES | CC[C@@H](O)/C=C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC(CO)CO |
| InChI | InChI=1S/C23H36O5/c1-2-21(26)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-23(27)28-22(19-24)20-25/h4-7,10-13,15,17,21-22,24-26H,2-3,8-9,14,16,18-20H2,1H3/b6-4-,7-5-,12-10-,13-11-,17-15+/t21-/m1/s1 |
| InChIKey | QIAFDKLSNJZANI-HCTUFHRVSA-N |
| XLogP | 3.78 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|