C36H60O6 — CID 157005499
[(2S)-3-hydroxy-2-(10-methyldodecanoyloxy)propyl] (5Z,8Z,11Z,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoate (PubChem CID 157005499) has the molecular formula C36H60O6 and a molecular weight of 588.87 g/mol. Its IUPAC name is [(2S)-3-hydroxy-2-(10-methyldodecanoyloxy)propyl] (5Z,8Z,11Z,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoate.
| Compound Name | [(2S)-3-hydroxy-2-(10-methyldodecanoyloxy)propyl] (5Z,8Z,11Z,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoate |
|---|---|
| PubChem CID | 157005499 |
| Molecular Formula | C36H60O6 |
| Molecular Weight | 588.87 g/mol |
| Exact Mass | 588.44 |
| IUPAC Name | [(2S)-3-hydroxy-2-(10-methyldodecanoyloxy)propyl] (5Z,8Z,11Z,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoate |
| SMILES | CCC(C)CCCCCCCCC(=O)O[C@@H](CO)COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\C=C\[C@@H](O)CC |
| InChI | InChI=1S/C36H60O6/c1-4-32(3)26-22-18-16-17-21-25-29-36(40)42-34(30-37)31-41-35(39)28-24-20-15-13-11-9-7-6-8-10-12-14-19-23-27-33(38)5-2/h7-10,13-15,19,23,27,32-34,37-38H,4-6,11-12,16-18,20-22,24-26,28-31H2,1-3H3/b9-7-,10-8-,15-13-,19-14-,27-23+/t32?,33-,34-/m0/s1 |
| InChIKey | UUPSIVRVJSEAEV-ITLFYKJBSA-N |
| XLogP | 8.49 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.87 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|