C36H62O6 — CID 157005414
[(2S)-1-hydroxy-3-(10-methyldodecanoyloxy)propan-2-yl] (5Z,8Z,10E,12S,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate (PubChem CID 157005414) has the molecular formula C36H62O6 and a molecular weight of 590.89 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-(10-methyldodecanoyloxy)propan-2-yl] (5Z,8Z,10E,12S,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate.
| Compound Name | [(2S)-1-hydroxy-3-(10-methyldodecanoyloxy)propan-2-yl] (5Z,8Z,10E,12S,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 157005414 |
| Molecular Formula | C36H62O6 |
| Molecular Weight | 590.89 g/mol |
| Exact Mass | 590.45 |
| IUPAC Name | [(2S)-1-hydroxy-3-(10-methyldodecanoyloxy)propan-2-yl] (5Z,8Z,10E,12S,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate |
| SMILES | CCCCC/C=C\C[C@H](O)/C=C/C=C\C/C=C\CCCC(=O)O[C@@H](CO)COC(=O)CCCCCCCCC(C)CC |
| InChI | InChI=1S/C36H62O6/c1-4-6-7-8-16-21-26-33(38)27-22-17-11-9-10-12-19-24-29-36(40)42-34(30-37)31-41-35(39)28-23-18-14-13-15-20-25-32(3)5-2/h10-12,16-17,21-22,27,32-34,37-38H,4-9,13-15,18-20,23-26,28-31H2,1-3H3/b12-10-,17-11-,21-16-,27-22+/t32?,33-,34-/m0/s1 |
| InChIKey | AVQIQZITIJIPQP-YMQQKRNASA-N |
| XLogP | 8.72 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.89 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|