C11H16O4 — CID 88682053
methyl (6Z,8E)-5-hydroxy-10-oxodeca-6,8-dienoate (PubChem CID 88682053) has the molecular formula C11H16O4 and a molecular weight of 212.25 g/mol. Its IUPAC name is methyl (6Z,8E)-5-hydroxy-10-oxodeca-6,8-dienoate.
| Compound Name | methyl (6Z,8E)-5-hydroxy-10-oxodeca-6,8-dienoate |
|---|---|
| PubChem CID | 88682053 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | methyl (6Z,8E)-5-hydroxy-10-oxodeca-6,8-dienoate |
| SMILES | COC(=O)CCCC(O)/C=C\C=C\C=O |
| InChI | InChI=1S/C11H16O4/c1-15-11(14)8-5-7-10(13)6-3-2-4-9-12/h2-4,6,9-10,13H,5,7-8H2,1H3/b4-2+,6-3- |
| InChIKey | IYTNEBJMZDVACT-FXVFINMBSA-N |
| XLogP | 1.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|