C21H34F2O3 — CID 23237819
methyl (6Z,8E,10E)-5,5-difluoro-12-hydroxyicosa-6,8,10-trienoate (PubChem CID 23237819) has the molecular formula C21H34F2O3 and a molecular weight of 372.50 g/mol. Its IUPAC name is methyl (6Z,8E,10E)-5,5-difluoro-12-hydroxyicosa-6,8,10-trienoate.
| Compound Name | methyl (6Z,8E,10E)-5,5-difluoro-12-hydroxyicosa-6,8,10-trienoate |
|---|---|
| PubChem CID | 23237819 |
| Molecular Formula | C21H34F2O3 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | methyl (6Z,8E,10E)-5,5-difluoro-12-hydroxyicosa-6,8,10-trienoate |
| SMILES | CCCCCCCCC(O)/C=C/C=C/C=C\C(F)(F)CCCC(=O)OC |
| InChI | InChI=1S/C21H34F2O3/c1-3-4-5-6-7-10-14-19(24)15-11-8-9-12-17-21(22,23)18-13-16-20(25)26-2/h8-9,11-12,15,17,19,24H,3-7,10,13-14,16,18H2,1-2H3/b9-8+,15-11+,17-12- |
| InChIKey | ARCBYCHSIIKSDH-HRBORFFFSA-N |
| XLogP | 5.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|