C23H30O5Y-2 — CID 59263594
benzene;methyl (5S,6E,8Z,10E,12E,14R,15R)-5,14,15-trihydroxyhexadeca-6,8,10,12-tetraenoate;yttrium (PubChem CID 59263594) has the molecular formula C23H30O5Y-2 and a molecular weight of 475.39 g/mol. Its IUPAC name is benzene;methyl (5S,6E,8Z,10E,12E,14R,15R)-5,14,15-trihydroxyhexadeca-6,8,10,12-tetraenoate;yttrium.
| Compound Name | benzene;methyl (5S,6E,8Z,10E,12E,14R,15R)-5,14,15-trihydroxyhexadeca-6,8,10,12-tetraenoate;yttrium |
|---|---|
| PubChem CID | 59263594 |
| Molecular Formula | C23H30O5Y-2 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | benzene;methyl (5S,6E,8Z,10E,12E,14R,15R)-5,14,15-trihydroxyhexadeca-6,8,10,12-tetraenoate;yttrium |
| SMILES | [CH2-][C@@H](O)[C@H](O)/C=C/C=C/C=C\C=C\[C@@H](O)CCCC(=O)OC.[Y].[c-]1ccccc1 |
| InChI | InChI=1S/C17H25O5.C6H5.Y/c1-14(18)16(20)12-8-6-4-3-5-7-10-15(19)11-9-13-17(21)22-2;1-2-4-6-5-3-1;/h3-8,10,12,14-16,18-20H,1,9,11,13H2,2H3;1-5H;/q2*-1;/b5-3-,6-4+,10-7+,12-8+;;/t14-,15-,16-;;/m1../s1 |
| InChIKey | WPNLRXUDGDMDFT-XCXQLZLXSA-N |
| XLogP | 2.96 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|