C20H31O4- — CID 122164872
(5S,6Z,8E,14Z)-5-hydroxy-12-oxoicosa-6,8,14-trienoate (PubChem CID 122164872) has the molecular formula C20H31O4- and a molecular weight of 335.46 g/mol. Its IUPAC name is (5S,6Z,8E,14Z)-5-hydroxy-12-oxoicosa-6,8,14-trienoate.
| Compound Name | (5S,6Z,8E,14Z)-5-hydroxy-12-oxoicosa-6,8,14-trienoate |
|---|---|
| PubChem CID | 122164872 |
| Molecular Formula | C20H31O4- |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (5S,6Z,8E,14Z)-5-hydroxy-12-oxoicosa-6,8,14-trienoate |
| SMILES | CCCCC/C=C\CC(=O)CC/C=C/C=C\[C@@H](O)CCCC(=O)[O-] |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h6-9,11,15,19,22H,2-5,10,12-14,16-17H2,1H3,(H,23,24)/p-1/b8-7+,9-6-,15-11-/t19-/m1/s1 |
| InChIKey | AHHXLFNPCWCNQF-WWIKSGRJSA-M |
| XLogP | 3.26 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|