C18H32O5 — CID 23872026
(11E,15Z)-9,10,13-trihydroxyoctadeca-11,15-dienoic acid (PubChem CID 23872026) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is (11E,15Z)-9,10,13-trihydroxyoctadeca-11,15-dienoic acid.
| Compound Name | (11E,15Z)-9,10,13-trihydroxyoctadeca-11,15-dienoic acid |
|---|---|
| PubChem CID | 23872026 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (11E,15Z)-9,10,13-trihydroxyoctadeca-11,15-dienoic acid |
| SMILES | CC/C=C\CC(O)/C=C/C(O)C(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O5/c1-2-3-7-10-15(19)13-14-17(21)16(20)11-8-5-4-6-9-12-18(22)23/h3,7,13-17,19-21H,2,4-6,8-12H2,1H3,(H,22,23)/b7-3-,14-13+ |
| InChIKey | ADHVWICOFLYDST-MKZMYESJSA-N |
| XLogP | 2.80 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|