C18H30O4 — CID 59931979
(11E,15Z)-13-hydroxy-10-oxooctadeca-11,15-dienoic acid (PubChem CID 59931979) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is (11E,15Z)-13-hydroxy-10-oxooctadeca-11,15-dienoic acid.
| Compound Name | (11E,15Z)-13-hydroxy-10-oxooctadeca-11,15-dienoic acid |
|---|---|
| PubChem CID | 59931979 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (11E,15Z)-13-hydroxy-10-oxooctadeca-11,15-dienoic acid |
| SMILES | CC/C=C\CC(O)/C=C/C(=O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O4/c1-2-3-8-11-16(19)14-15-17(20)12-9-6-4-5-7-10-13-18(21)22/h3,8,14-16,19H,2,4-7,9-13H2,1H3,(H,21,22)/b8-3-,15-14+ |
| InChIKey | MHALAIOXRHAOFI-IQPNXQBCSA-N |
| XLogP | 4.03 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|