C22H34O2 — CID 87522953
(3Z,6S,7E,9Z,12Z,14E,16S,18Z)-docosa-3,7,9,12,14,18-hexaene-6,16-diol (PubChem CID 87522953) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is (3Z,6S,7E,9Z,12Z,14E,16S,18Z)-docosa-3,7,9,12,14,18-hexaene-6,16-diol.
| Compound Name | (3Z,6S,7E,9Z,12Z,14E,16S,18Z)-docosa-3,7,9,12,14,18-hexaene-6,16-diol |
|---|---|
| PubChem CID | 87522953 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (3Z,6S,7E,9Z,12Z,14E,16S,18Z)-docosa-3,7,9,12,14,18-hexaene-6,16-diol |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\C/C=C\C=C\[C@@H](O)C/C=C\CCC |
| InChI | InChI=1S/C22H34O2/c1-3-5-7-14-18-22(24)20-16-12-10-8-9-11-15-19-21(23)17-13-6-4-2/h6-7,9-16,19-24H,3-5,8,17-18H2,1-2H3/b11-9-,12-10-,13-6-,14-7-,19-15+,20-16+/t21-,22-/m0/s1 |
| InChIKey | VORCNQDCRCKQSM-HDAGNCOISA-N |
| XLogP | 5.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|