C23H36O2 — CID 118041907
(4Z,8E,10E,12Z,16Z,19Z)-14-methyldocosa-4,8,10,12,16,19-hexaene-7,14-diol (PubChem CID 118041907) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is (4Z,8E,10E,12Z,16Z,19Z)-14-methyldocosa-4,8,10,12,16,19-hexaene-7,14-diol.
| Compound Name | (4Z,8E,10E,12Z,16Z,19Z)-14-methyldocosa-4,8,10,12,16,19-hexaene-7,14-diol |
|---|---|
| PubChem CID | 118041907 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (4Z,8E,10E,12Z,16Z,19Z)-14-methyldocosa-4,8,10,12,16,19-hexaene-7,14-diol |
| SMILES | CC/C=C\C/C=C\CC(C)(O)/C=C\C=C\C=C\C(O)C/C=C\CCC |
| InChI | InChI=1S/C23H36O2/c1-4-6-8-10-12-16-20-23(3,25)21-17-13-11-15-19-22(24)18-14-9-7-5-2/h6,8-9,11-17,19,21-22,24-25H,4-5,7,10,18,20H2,1-3H3/b8-6-,13-11+,14-9-,16-12-,19-15+,21-17- |
| InChIKey | CSDDJEJMVVZGBG-BWUKENBESA-N |
| XLogP | 5.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|