C22H32O2 — CID 88953533
(4Z,7Z,10Z,13Z,17E,19Z)-16-hydroxydocosa-4,7,10,13,17,19-hexaenal (PubChem CID 88953533) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,17E,19Z)-16-hydroxydocosa-4,7,10,13,17,19-hexaenal.
| Compound Name | (4Z,7Z,10Z,13Z,17E,19Z)-16-hydroxydocosa-4,7,10,13,17,19-hexaenal |
|---|---|
| PubChem CID | 88953533 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (4Z,7Z,10Z,13Z,17E,19Z)-16-hydroxydocosa-4,7,10,13,17,19-hexaenal |
| SMILES | CC/C=C\C=C\C(O)C/C=C\C/C=C\C/C=C\C/C=C\CCC=O |
| InChI | InChI=1S/C22H32O2/c1-2-3-4-16-19-22(24)20-17-14-12-10-8-6-5-7-9-11-13-15-18-21-23/h3-5,7-8,10-11,13-14,16-17,19,21-22,24H,2,6,9,12,15,18,20H2,1H3/b4-3-,7-5-,10-8-,13-11-,17-14-,19-16+ |
| InChIKey | GSJQQAQBBFZRRM-DLADYCGASA-N |
| XLogP | 5.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|