C18H30O — CID 89023941
(3Z,7E,9Z,12Z)-octadeca-3,7,9,12-tetraen-6-ol (PubChem CID 89023941) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is (3Z,7E,9Z,12Z)-octadeca-3,7,9,12-tetraen-6-ol.
| Compound Name | (3Z,7E,9Z,12Z)-octadeca-3,7,9,12-tetraen-6-ol |
|---|---|
| PubChem CID | 89023941 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | (3Z,7E,9Z,12Z)-octadeca-3,7,9,12-tetraen-6-ol |
| SMILES | CC/C=C\CC(O)/C=C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C18H30O/c1-3-5-7-8-9-10-11-12-13-15-17-18(19)16-14-6-4-2/h6,9-10,12-15,17-19H,3-5,7-8,11,16H2,1-2H3/b10-9-,13-12-,14-6-,17-15+ |
| InChIKey | DURIZVOEBLGXAP-BSFWWIGASA-N |
| XLogP | 5.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|