C20H32O4 — CID 3399283
12-hydroxyicosa-5,8,10,14-tetraeneperoxoic acid (PubChem CID 3399283) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 12-hydroxyicosa-5,8,10,14-tetraeneperoxoic acid.
| Compound Name | 12-hydroxyicosa-5,8,10,14-tetraeneperoxoic acid |
|---|---|
| PubChem CID | 3399283 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 12-hydroxyicosa-5,8,10,14-tetraeneperoxoic acid |
| SMILES | CCCCCC=CCC(O)C=CC=CCC=CCCCC(=O)OO |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-10-13-16-19(21)17-14-11-8-6-7-9-12-15-18-20(22)24-23/h7-11,13-14,17,19,21,23H,2-6,12,15-16,18H2,1H3 |
| InChIKey | QAKIPJXLPIRYMJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|