C18H29O- — CID 91320303
(3Z,6Z,10Z,12Z)-octadeca-3,6,10,12-tetraen-9-ol (PubChem CID 91320303) has the molecular formula C18H29O- and a molecular weight of 261.43 g/mol. Its IUPAC name is (3Z,6Z,10Z,12Z)-octadeca-3,6,10,12-tetraen-9-ol.
| Compound Name | (3Z,6Z,10Z,12Z)-octadeca-3,6,10,12-tetraen-9-ol |
|---|---|
| PubChem CID | 91320303 |
| Molecular Formula | C18H29O- |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | (3Z,6Z,10Z,12Z)-octadeca-3,6,10,12-tetraen-9-ol |
| SMILES | [CH2-]CCCC/C=C\C=C/C(O)C/C=C\C/C=C\CC |
| InChI | InChI=1S/C18H29O/c1-3-5-7-9-11-13-15-17-18(19)16-14-12-10-8-6-4-2/h6,8,11-15,17-19H,1,3-5,7,9-10,16H2,2H3/q-1/b8-6-,13-11-,14-12-,17-15- |
| InChIKey | ZPWJCBISKOTQKK-JSEIFMOSSA-N |
| XLogP | 5.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|