C14H18O2 — CID 15755837
(2E,4E,6E,8E,10E)-12-hydroxytetradeca-2,4,6,8,10-pentaenal (PubChem CID 15755837) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E)-12-hydroxytetradeca-2,4,6,8,10-pentaenal.
| Compound Name | (2E,4E,6E,8E,10E)-12-hydroxytetradeca-2,4,6,8,10-pentaenal |
|---|---|
| PubChem CID | 15755837 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (2E,4E,6E,8E,10E)-12-hydroxytetradeca-2,4,6,8,10-pentaenal |
| SMILES | CCC(O)/C=C/C=C/C=C/C=C/C=C/C=O |
| InChI | InChI=1S/C14H18O2/c1-2-14(16)12-10-8-6-4-3-5-7-9-11-13-15/h3-14,16H,2H2,1H3/b4-3+,7-5+,8-6+,11-9+,12-10+ |
| InChIKey | QINJKIPCROFKRJ-RZLSLBLSSA-N |
| XLogP | 2.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|