C18H28O4 — CID 88909320
(6S,7R,8E,10E,12Z,14E,16S)-6,7,16-trihydroxyoctadeca-8,10,12,14-tetraen-2-one (PubChem CID 88909320) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is (6S,7R,8E,10E,12Z,14E,16S)-6,7,16-trihydroxyoctadeca-8,10,12,14-tetraen-2-one.
| Compound Name | (6S,7R,8E,10E,12Z,14E,16S)-6,7,16-trihydroxyoctadeca-8,10,12,14-tetraen-2-one |
|---|---|
| PubChem CID | 88909320 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (6S,7R,8E,10E,12Z,14E,16S)-6,7,16-trihydroxyoctadeca-8,10,12,14-tetraen-2-one |
| SMILES | CC[C@H](O)/C=C/C=C\C=C\C=C\[C@@H](O)[C@@H](O)CCCC(C)=O |
| InChI | InChI=1S/C18H28O4/c1-3-16(20)12-8-6-4-5-7-9-13-17(21)18(22)14-10-11-15(2)19/h4-9,12-13,16-18,20-22H,3,10-11,14H2,1-2H3/b6-4-,7-5+,12-8+,13-9+/t16-,17+,18-/m0/s1 |
| InChIKey | UXJALYLEEBLVJT-YGSUGLSDSA-N |
| XLogP | 2.46 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|